About ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(2-amino-2-oxoethyl)carbamate;propane
ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(2-amino-2-oxoethyl)carbamate;propane (PubChem CID 144729711) has the molecular formula C15H30N2O3
and a molecular weight of 286.42 g/mol. Its IUPAC name is ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(2-amino-2-oxoethyl)carbamate;propane.
Molecular Properties
| Compound Name | ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(2-amino-2-oxoethyl)carbamate;propane |
| PubChem CID | 144729711 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(2-amino-2-oxoethyl)carbamate;propane |
| SMILES | C/C=C\C(=C/C)COC(=O)NCC(N)=O.CC.CCC |
| InChI | InChI=1S/C10H16N2O3.C3H8.C2H6/c1-3-5-8(4-2)7-15-10(14)12-6-9(11)13;1-3-2;1-2/h3-5H,6-7H2,1-2H3,(H2,11,13)(H,12,14);3H2,1-2H3;1-2H3/b5-3-,8-4+;; |
| InChIKey | PUXAGGLHLYEWRP-LILUTQJSSA-N |
| XLogP | 3.16 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(2-amino-2-oxoethyl)carbamate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(2-amino-2-oxoethyl)carbamate;propane?
The IUPAC name of ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(2-amino-2-oxoethyl)carbamate;propane (CID 144729711) is ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(2-amino-2-oxoethyl)carbamate;propane.
What is the SMILES notation for ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(2-amino-2-oxoethyl)carbamate;propane?
The canonical SMILES for ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(2-amino-2-oxoethyl)carbamate;propane is C/C=C\C(=C/C)COC(=O)NCC(N)=O.CC.CCC.
What is the InChIKey of ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(2-amino-2-oxoethyl)carbamate;propane?
The InChIKey is PUXAGGLHLYEWRP-LILUTQJSSA-N. The full InChI is InChI=1S/C10H16N2O3.C3H8.C2H6/c1-3-5-8(4-2)7-15-10(14)12-6-9(11)13;1-3-2;1-2/h3-5H,6-7H2,1-2H3,(H2,11,13)(H,12,14);3H2,1-2H3;1-2H3/b5-3-,8-4+;;.
What are the key properties of ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(2-amino-2-oxoethyl)carbamate;propane?
ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(2-amino-2-oxoethyl)carbamate;propane has a molecular weight of 286.42 g/mol, XLogP of 3.16, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(2-amino-2-oxoethyl)carbamate;propane is sourced from PubChem (CID 144729711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).