C47H42N2 — CID 144730353
N-[(1Z,3Z)-hexa-1,3,5-trienyl]-N-[4-[4-(N-[4-(4-methylcyclohexa-1,3-dien-1-yl)phenyl]anilino)phenyl]cyclohexa-1,5-dien-1-yl]naphthalen-1-amine (PubChem CID 144730353) has the molecular formula C47H42N2 and a molecular weight of 634.87 g/mol. Its IUPAC name is N-[(1Z,3Z)-hexa-1,3,5-trienyl]-N-[4-[4-(N-[4-(4-methylcyclohexa-1,3-dien-1-yl)phenyl]anilino)phenyl]cyclohexa-1,5-dien-1-yl]naphthalen-1-amine.
| Compound Name | N-[(1Z,3Z)-hexa-1,3,5-trienyl]-N-[4-[4-(N-[4-(4-methylcyclohexa-1,3-dien-1-yl)phenyl]anilino)phenyl]cyclohexa-1,5-dien-1-yl]naphthalen-1-amine |
|---|---|
| PubChem CID | 144730353 |
| Molecular Formula | C47H42N2 |
| Molecular Weight | 634.87 g/mol |
| Exact Mass | 634.33 |
| IUPAC Name | N-[(1Z,3Z)-hexa-1,3,5-trienyl]-N-[4-[4-(N-[4-(4-methylcyclohexa-1,3-dien-1-yl)phenyl]anilino)phenyl]cyclohexa-1,5-dien-1-yl]naphthalen-1-amine |
| SMILES | C=C/C=C\C=C/N(C1=CCC(c2ccc(N(c3ccccc3)c3ccc(C4=CC=C(C)CC4)cc3)cc2)C=C1)c1cccc2ccccc12 |
| InChI | InChI=1S/C47H42N2/c1-3-4-5-11-35-48(47-18-12-14-41-13-9-10-17-46(41)47)42-29-23-38(24-30-42)40-27-33-45(34-28-40)49(43-15-7-6-8-16-43)44-31-25-39(26-32-44)37-21-19-36(2)20-22-37/h3-19,21,23,25-35,38H,1,20,22,24H2,2H3/b5-4-,35-11- |
| InChIKey | JGSQAVJJGHCBQM-DYECFBSKSA-N |
| XLogP | 13.12 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.87 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|