C11H16Cl2N2S — CID 144730432
(1E,5Z,7Z)-6,8-dichloro-3-methyl-2-propylsulfanyl-3,4-dihydroazocin-7-amine (PubChem CID 144730432) has the molecular formula C11H16Cl2N2S and a molecular weight of 279.24 g/mol. Its IUPAC name is (1E,5Z,7Z)-6,8-dichloro-3-methyl-2-propylsulfanyl-3,4-dihydroazocin-7-amine.
| Compound Name | (1E,5Z,7Z)-6,8-dichloro-3-methyl-2-propylsulfanyl-3,4-dihydroazocin-7-amine |
|---|---|
| PubChem CID | 144730432 |
| Molecular Formula | C11H16Cl2N2S |
| Molecular Weight | 279.24 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | (1E,5Z,7Z)-6,8-dichloro-3-methyl-2-propylsulfanyl-3,4-dihydroazocin-7-amine |
| SMILES | CCCS/C1=N/C(Cl)=C(N)\C(Cl)=C/CC1C |
| InChI | InChI=1S/C11H16Cl2N2S/c1-3-6-16-11-7(2)4-5-8(12)9(14)10(13)15-11/h5,7H,3-4,6,14H2,1-2H3/b8-5+,10-9+,15-11+ |
| InChIKey | WFLITXPTPXPZQN-BNKWQGFMSA-N |
| XLogP | 4.06 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.24 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|