C21H21Cl2N5O2 — CID 144730858
5-amino-6-[amino-[1-(4-chlorophenyl)propyl]amino]-5'-chlorospiro[1,3-dihydropyridine-4,3'-1H-indole]-2,2'-dione (PubChem CID 144730858) has the molecular formula C21H21Cl2N5O2 and a molecular weight of 446.34 g/mol. Its IUPAC name is 5-amino-6-[amino-[1-(4-chlorophenyl)propyl]amino]-5'-chlorospiro[1,3-dihydropyridine-4,3'-1H-indole]-2,2'-dione.
| Compound Name | 5-amino-6-[amino-[1-(4-chlorophenyl)propyl]amino]-5'-chlorospiro[1,3-dihydropyridine-4,3'-1H-indole]-2,2'-dione |
|---|---|
| PubChem CID | 144730858 |
| Molecular Formula | C21H21Cl2N5O2 |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 5-amino-6-[amino-[1-(4-chlorophenyl)propyl]amino]-5'-chlorospiro[1,3-dihydropyridine-4,3'-1H-indole]-2,2'-dione |
| SMILES | CCC(c1ccc(Cl)cc1)N(N)C1=C(N)C2(CC(=O)N1)C(=O)Nc1ccc(Cl)cc12 |
| InChI | InChI=1S/C21H21Cl2N5O2/c1-2-16(11-3-5-12(22)6-4-11)28(25)19-18(24)21(10-17(29)27-19)14-9-13(23)7-8-15(14)26-20(21)30/h3-9,16H,2,10,24-25H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | NPWORMJDDLHKFT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|