C19H17Cl2N5O2 — CID 144730887
(4R)-5-amino-6-[amino-[(4-chlorophenyl)methyl]amino]-5'-chlorospiro[1,3-dihydropyridine-4,3'-1H-indole]-2,2'-dione (PubChem CID 144730887) has the molecular formula C19H17Cl2N5O2 and a molecular weight of 418.28 g/mol. Its IUPAC name is (4R)-5-amino-6-[amino-[(4-chlorophenyl)methyl]amino]-5'-chlorospiro[1,3-dihydropyridine-4,3'-1H-indole]-2,2'-dione.
| Compound Name | (4R)-5-amino-6-[amino-[(4-chlorophenyl)methyl]amino]-5'-chlorospiro[1,3-dihydropyridine-4,3'-1H-indole]-2,2'-dione |
|---|---|
| PubChem CID | 144730887 |
| Molecular Formula | C19H17Cl2N5O2 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | (4R)-5-amino-6-[amino-[(4-chlorophenyl)methyl]amino]-5'-chlorospiro[1,3-dihydropyridine-4,3'-1H-indole]-2,2'-dione |
| SMILES | NC1=C(N(N)Cc2ccc(Cl)cc2)NC(=O)C[C@]12C(=O)Nc1ccc(Cl)cc12 |
| InChI | InChI=1S/C19H17Cl2N5O2/c20-11-3-1-10(2-4-11)9-26(23)17-16(22)19(8-15(27)25-17)13-7-12(21)5-6-14(13)24-18(19)28/h1-7H,8-9,22-23H2,(H,24,28)(H,25,27)/t19-/m1/s1 |
| InChIKey | KVBOREGCWQCLDM-LJQANCHMSA-N |
| XLogP | 2.21 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|