C20H19Cl2N5O2 — CID 144730888
(4R)-5-amino-6-[amino-[1-(4-chlorophenyl)ethyl]amino]-5'-chlorospiro[1,3-dihydropyridine-4,3'-1H-indole]-2,2'-dione (PubChem CID 144730888) has the molecular formula C20H19Cl2N5O2 and a molecular weight of 432.31 g/mol. Its IUPAC name is (4R)-5-amino-6-[amino-[1-(4-chlorophenyl)ethyl]amino]-5'-chlorospiro[1,3-dihydropyridine-4,3'-1H-indole]-2,2'-dione.
| Compound Name | (4R)-5-amino-6-[amino-[1-(4-chlorophenyl)ethyl]amino]-5'-chlorospiro[1,3-dihydropyridine-4,3'-1H-indole]-2,2'-dione |
|---|---|
| PubChem CID | 144730888 |
| Molecular Formula | C20H19Cl2N5O2 |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | (4R)-5-amino-6-[amino-[1-(4-chlorophenyl)ethyl]amino]-5'-chlorospiro[1,3-dihydropyridine-4,3'-1H-indole]-2,2'-dione |
| SMILES | CC(c1ccc(Cl)cc1)N(N)C1=C(N)[C@]2(CC(=O)N1)C(=O)Nc1ccc(Cl)cc12 |
| InChI | InChI=1S/C20H19Cl2N5O2/c1-10(11-2-4-12(21)5-3-11)27(24)18-17(23)20(9-16(28)26-18)14-8-13(22)6-7-15(14)25-19(20)29/h2-8,10H,9,23-24H2,1H3,(H,25,29)(H,26,28)/t10?,20-/m1/s1 |
| InChIKey | MXDILHVMDHSQBP-AKYJZCGHSA-N |
| XLogP | 2.77 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|