About 3-[(E)-prop-1-enyl]-1,2,4-thiadiazol-5-amine
3-[(E)-prop-1-enyl]-1,2,4-thiadiazol-5-amine (PubChem CID 144731094) has the molecular formula C5H7N3S
and a molecular weight of 141.20 g/mol. Its IUPAC name is 3-[(E)-prop-1-enyl]-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | 3-[(E)-prop-1-enyl]-1,2,4-thiadiazol-5-amine |
| PubChem CID | 144731094 |
| Molecular Formula | C5H7N3S |
| Molecular Weight | 141.20 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | 3-[(E)-prop-1-enyl]-1,2,4-thiadiazol-5-amine |
| SMILES | C/C=C/c1nsc(N)n1 |
| InChI | InChI=1S/C5H7N3S/c1-2-3-4-7-5(6)9-8-4/h2-3H,1H3,(H2,6,7,8)/b3-2+ |
| InChIKey | VVEORBXQKQZVBJ-NSCUHMNNSA-N |
| XLogP | 1.15 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(E)-prop-1-enyl]-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-prop-1-enyl]-1,2,4-thiadiazol-5-amine?
The IUPAC name of 3-[(E)-prop-1-enyl]-1,2,4-thiadiazol-5-amine (CID 144731094) is 3-[(E)-prop-1-enyl]-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for 3-[(E)-prop-1-enyl]-1,2,4-thiadiazol-5-amine?
The canonical SMILES for 3-[(E)-prop-1-enyl]-1,2,4-thiadiazol-5-amine is C/C=C/c1nsc(N)n1.
What is the InChIKey of 3-[(E)-prop-1-enyl]-1,2,4-thiadiazol-5-amine?
The InChIKey is VVEORBXQKQZVBJ-NSCUHMNNSA-N. The full InChI is InChI=1S/C5H7N3S/c1-2-3-4-7-5(6)9-8-4/h2-3H,1H3,(H2,6,7,8)/b3-2+.
What are the key properties of 3-[(E)-prop-1-enyl]-1,2,4-thiadiazol-5-amine?
3-[(E)-prop-1-enyl]-1,2,4-thiadiazol-5-amine has a molecular weight of 141.20 g/mol, XLogP of 1.15, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-prop-1-enyl]-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 144731094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).