About 5-[(E)-prop-1-enyl]-2,3-dihydrothiophen-2-amine
5-[(E)-prop-1-enyl]-2,3-dihydrothiophen-2-amine (PubChem CID 144731289) has the molecular formula C7H11NS
and a molecular weight of 141.24 g/mol. Its IUPAC name is 5-[(E)-prop-1-enyl]-2,3-dihydrothiophen-2-amine.
Molecular Properties
| Compound Name | 5-[(E)-prop-1-enyl]-2,3-dihydrothiophen-2-amine |
| PubChem CID | 144731289 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 5-[(E)-prop-1-enyl]-2,3-dihydrothiophen-2-amine |
| SMILES | C/C=C/C1=CCC(N)S1 |
| InChI | InChI=1S/C7H11NS/c1-2-3-6-4-5-7(8)9-6/h2-4,7H,5,8H2,1H3/b3-2+ |
| InChIKey | UYUBDJGUFHBIKR-NSCUHMNNSA-N |
| XLogP | 1.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(E)-prop-1-enyl]-2,3-dihydrothiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-prop-1-enyl]-2,3-dihydrothiophen-2-amine?
The IUPAC name of 5-[(E)-prop-1-enyl]-2,3-dihydrothiophen-2-amine (CID 144731289) is 5-[(E)-prop-1-enyl]-2,3-dihydrothiophen-2-amine.
What is the SMILES notation for 5-[(E)-prop-1-enyl]-2,3-dihydrothiophen-2-amine?
The canonical SMILES for 5-[(E)-prop-1-enyl]-2,3-dihydrothiophen-2-amine is C/C=C/C1=CCC(N)S1.
What is the InChIKey of 5-[(E)-prop-1-enyl]-2,3-dihydrothiophen-2-amine?
The InChIKey is UYUBDJGUFHBIKR-NSCUHMNNSA-N. The full InChI is InChI=1S/C7H11NS/c1-2-3-6-4-5-7(8)9-6/h2-4,7H,5,8H2,1H3/b3-2+.
What are the key properties of 5-[(E)-prop-1-enyl]-2,3-dihydrothiophen-2-amine?
5-[(E)-prop-1-enyl]-2,3-dihydrothiophen-2-amine has a molecular weight of 141.24 g/mol, XLogP of 1.87, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-prop-1-enyl]-2,3-dihydrothiophen-2-amine is sourced from PubChem (CID 144731289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).