About (1Z,3Z)-1-methylsulfanylpenta-1,3-dien-3-ol
(1Z,3Z)-1-methylsulfanylpenta-1,3-dien-3-ol (PubChem CID 144731327) has the molecular formula C6H10OS
and a molecular weight of 130.21 g/mol. Its IUPAC name is (1Z,3Z)-1-methylsulfanylpenta-1,3-dien-3-ol.
Molecular Properties
| Compound Name | (1Z,3Z)-1-methylsulfanylpenta-1,3-dien-3-ol |
| PubChem CID | 144731327 |
| Molecular Formula | C6H10OS |
| Molecular Weight | 130.21 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | (1Z,3Z)-1-methylsulfanylpenta-1,3-dien-3-ol |
| SMILES | C/C=C(O)/C=C\SC |
| InChI | InChI=1S/C6H10OS/c1-3-6(7)4-5-8-2/h3-5,7H,1-2H3/b5-4-,6-3- |
| InChIKey | UBAZQWZKSWEDSM-QXYVOPKASA-N |
| XLogP | 2.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z,3Z)-1-methylsulfanylpenta-1,3-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,3Z)-1-methylsulfanylpenta-1,3-dien-3-ol?
The IUPAC name of (1Z,3Z)-1-methylsulfanylpenta-1,3-dien-3-ol (CID 144731327) is (1Z,3Z)-1-methylsulfanylpenta-1,3-dien-3-ol.
What is the SMILES notation for (1Z,3Z)-1-methylsulfanylpenta-1,3-dien-3-ol?
The canonical SMILES for (1Z,3Z)-1-methylsulfanylpenta-1,3-dien-3-ol is C/C=C(O)/C=C\SC.
What is the InChIKey of (1Z,3Z)-1-methylsulfanylpenta-1,3-dien-3-ol?
The InChIKey is UBAZQWZKSWEDSM-QXYVOPKASA-N. The full InChI is InChI=1S/C6H10OS/c1-3-6(7)4-5-8-2/h3-5,7H,1-2H3/b5-4-,6-3-.
What are the key properties of (1Z,3Z)-1-methylsulfanylpenta-1,3-dien-3-ol?
(1Z,3Z)-1-methylsulfanylpenta-1,3-dien-3-ol has a molecular weight of 130.21 g/mol, XLogP of 2.32, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,3Z)-1-methylsulfanylpenta-1,3-dien-3-ol is sourced from PubChem (CID 144731327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).