C17H24FNS2 — CID 144731340
(2E,4E)-6-amino-2-ethenyl-4-ethyl-6-(2-fluorocyclohexa-1,3-dien-1-yl)-3-methylsulfanylhexa-2,4-diene-1-thiol (PubChem CID 144731340) has the molecular formula C17H24FNS2 and a molecular weight of 325.52 g/mol. Its IUPAC name is (2E,4E)-6-amino-2-ethenyl-4-ethyl-6-(2-fluorocyclohexa-1,3-dien-1-yl)-3-methylsulfanylhexa-2,4-diene-1-thiol.
| Compound Name | (2E,4E)-6-amino-2-ethenyl-4-ethyl-6-(2-fluorocyclohexa-1,3-dien-1-yl)-3-methylsulfanylhexa-2,4-diene-1-thiol |
|---|---|
| PubChem CID | 144731340 |
| Molecular Formula | C17H24FNS2 |
| Molecular Weight | 325.52 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (2E,4E)-6-amino-2-ethenyl-4-ethyl-6-(2-fluorocyclohexa-1,3-dien-1-yl)-3-methylsulfanylhexa-2,4-diene-1-thiol |
| SMILES | C=C/C(CS)=C(SC)/C(=C/C(N)C1=C(F)C=CCC1)CC |
| InChI | InChI=1S/C17H24FNS2/c1-4-12(17(21-3)13(5-2)11-20)10-16(19)14-8-6-7-9-15(14)18/h5,7,9-10,16,20H,2,4,6,8,11,19H2,1,3H3/b12-10+,17-13+ |
| InChIKey | SUMBZORQLBSPOT-QIYIKKHUSA-N |
| XLogP | 4.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|