C25H42FN3O6S — CID 144731794
[4-[(2R)-2-hydroxy-6-methylhept-5-en-3-yl]-5-methoxy-1-oxaspiro[2.5]octan-6-yl] N-[4-[[2-(fluorosulfanylamino)acetyl]amino]cyclohexyl]carbamate (PubChem CID 144731794) has the molecular formula C25H42FN3O6S and a molecular weight of 531.69 g/mol. Its IUPAC name is [4-[(2R)-2-hydroxy-6-methylhept-5-en-3-yl]-5-methoxy-1-oxaspiro[2.5]octan-6-yl] N-[4-[[2-(fluorosulfanylamino)acetyl]amino]cyclohexyl]carbamate.
| Compound Name | [4-[(2R)-2-hydroxy-6-methylhept-5-en-3-yl]-5-methoxy-1-oxaspiro[2.5]octan-6-yl] N-[4-[[2-(fluorosulfanylamino)acetyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 144731794 |
| Molecular Formula | C25H42FN3O6S |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | [4-[(2R)-2-hydroxy-6-methylhept-5-en-3-yl]-5-methoxy-1-oxaspiro[2.5]octan-6-yl] N-[4-[[2-(fluorosulfanylamino)acetyl]amino]cyclohexyl]carbamate |
| SMILES | COC1C(OC(=O)NC2CCC(NC(=O)CNSF)CC2)CCC2(CO2)C1C(CC=C(C)C)[C@@H](C)O |
| InChI | InChI=1S/C25H42FN3O6S/c1-15(2)5-10-19(16(3)30)22-23(33-4)20(11-12-25(22)14-34-25)35-24(32)29-18-8-6-17(7-9-18)28-21(31)13-27-36-26/h5,16-20,22-23,27,30H,6-14H2,1-4H3,(H,28,31)(H,29,32)/t16-,17?,18?,19?,20?,22?,23?,25?/m1/s1 |
| InChIKey | ZWAMJZOOAFNYRC-KMRSWRMESA-N |
| XLogP | 3.18 |
| TPSA | 121.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|