C31H18Cl6N6O — CID 14473259
4-[5-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-1,3,4-oxadiazol-2-yl]-N,N-diphenylaniline (PubChem CID 14473259) has the molecular formula C31H18Cl6N6O and a molecular weight of 703.24 g/mol. Its IUPAC name is 4-[5-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-1,3,4-oxadiazol-2-yl]-N,N-diphenylaniline.
| Compound Name | 4-[5-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-1,3,4-oxadiazol-2-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 14473259 |
| Molecular Formula | C31H18Cl6N6O |
| Molecular Weight | 703.24 g/mol |
| Exact Mass | 699.97 |
| IUPAC Name | 4-[5-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-1,3,4-oxadiazol-2-yl]-N,N-diphenylaniline |
| SMILES | ClC(Cl)(Cl)c1nc(-c2ccc(-c3nnc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)o3)cc2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C31H18Cl6N6O/c32-30(33,34)28-38-25(39-29(40-28)31(35,36)37)19-11-13-20(14-12-19)26-41-42-27(44-26)21-15-17-24(18-16-21)43(22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-18H |
| InChIKey | XYQQPBJUSOWLRE-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 80.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.24 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|