C32H42BN3O5 — CID 144733510
tert-butyl piperidine-1-carboxylate;N-isoquinolin-1-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 144733510) has the molecular formula C32H42BN3O5 and a molecular weight of 559.52 g/mol. Its IUPAC name is tert-butyl piperidine-1-carboxylate;N-isoquinolin-1-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | tert-butyl piperidine-1-carboxylate;N-isoquinolin-1-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 144733510 |
| Molecular Formula | C32H42BN3O5 |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 559.32 |
| IUPAC Name | tert-butyl piperidine-1-carboxylate;N-isoquinolin-1-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1.CC1(C)OB(c2ccc(C(=O)Nc3nccc4ccccc34)cc2)OC1(C)C |
| InChI | InChI=1S/C22H23BN2O3.C10H19NO2/c1-21(2)22(3,4)28-23(27-21)17-11-9-16(10-12-17)20(26)25-19-18-8-6-5-7-15(18)13-14-24-19;1-10(2,3)13-9(12)11-7-5-4-6-8-11/h5-14H,1-4H3,(H,24,25,26);4-8H2,1-3H3 |
| InChIKey | RIQVQJVCMZHQRS-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|