About 4-tert-butyloxane;ethane;N,N,4-trimethylcyclohexan-1-amine
4-tert-butyloxane;ethane;N,N,4-trimethylcyclohexan-1-amine (PubChem CID 144735000) has the molecular formula C20H43NO
and a molecular weight of 313.57 g/mol. Its IUPAC name is 4-tert-butyloxane;ethane;N,N,4-trimethylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-tert-butyloxane;ethane;N,N,4-trimethylcyclohexan-1-amine |
| PubChem CID | 144735000 |
| Molecular Formula | C20H43NO |
| Molecular Weight | 313.57 g/mol |
| Exact Mass | 313.33 |
| IUPAC Name | 4-tert-butyloxane;ethane;N,N,4-trimethylcyclohexan-1-amine |
| SMILES | CC.CC(C)(C)C1CCOCC1.CC1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C9H19N.C9H18O.C2H6/c1-8-4-6-9(7-5-8)10(2)3;1-9(2,3)8-4-6-10-7-5-8;1-2/h8-9H,4-7H2,1-3H3;8H,4-7H2,1-3H3;1-2H3 |
| InChIKey | VXBXHQQYMUNBPF-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyloxane;ethane;N,N,4-trimethylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyloxane;ethane;N,N,4-trimethylcyclohexan-1-amine?
The IUPAC name of 4-tert-butyloxane;ethane;N,N,4-trimethylcyclohexan-1-amine (CID 144735000) is 4-tert-butyloxane;ethane;N,N,4-trimethylcyclohexan-1-amine.
What is the SMILES notation for 4-tert-butyloxane;ethane;N,N,4-trimethylcyclohexan-1-amine?
The canonical SMILES for 4-tert-butyloxane;ethane;N,N,4-trimethylcyclohexan-1-amine is CC.CC(C)(C)C1CCOCC1.CC1CCC(N(C)C)CC1.
What is the InChIKey of 4-tert-butyloxane;ethane;N,N,4-trimethylcyclohexan-1-amine?
The InChIKey is VXBXHQQYMUNBPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.C9H18O.C2H6/c1-8-4-6-9(7-5-8)10(2)3;1-9(2,3)8-4-6-10-7-5-8;1-2/h8-9H,4-7H2,1-3H3;8H,4-7H2,1-3H3;1-2H3.
What are the key properties of 4-tert-butyloxane;ethane;N,N,4-trimethylcyclohexan-1-amine?
4-tert-butyloxane;ethane;N,N,4-trimethylcyclohexan-1-amine has a molecular weight of 313.57 g/mol, XLogP of 5.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyloxane;ethane;N,N,4-trimethylcyclohexan-1-amine is sourced from PubChem (CID 144735000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).