About N-(1,3-dimethylideneinden-4-yl)formamide;ethane;3-methyl-6-methylidenepiperidin-2-one
N-(1,3-dimethylideneinden-4-yl)formamide;ethane;3-methyl-6-methylidenepiperidin-2-one (PubChem CID 144735254) has the molecular formula C21H28N2O2
and a molecular weight of 340.47 g/mol. Its IUPAC name is N-(1,3-dimethylideneinden-4-yl)formamide;ethane;3-methyl-6-methylidenepiperidin-2-one.
Molecular Properties
| Compound Name | N-(1,3-dimethylideneinden-4-yl)formamide;ethane;3-methyl-6-methylidenepiperidin-2-one |
| PubChem CID | 144735254 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | N-(1,3-dimethylideneinden-4-yl)formamide;ethane;3-methyl-6-methylidenepiperidin-2-one |
| SMILES | C=C1CC(=C)c2c(NC=O)cccc21.C=C1CCC(C)C(=O)N1.CC |
| InChI | InChI=1S/C12H11NO.C7H11NO.C2H6/c1-8-6-9(2)12-10(8)4-3-5-11(12)13-7-14;1-5-3-4-6(2)8-7(5)9;1-2/h3-5,7H,1-2,6H2,(H,13,14);5H,2-4H2,1H3,(H,8,9);1-2H3 |
| InChIKey | SRSSOTNZFZNMOQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-dimethylideneinden-4-yl)formamide;ethane;3-methyl-6-methylidenepiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-dimethylideneinden-4-yl)formamide;ethane;3-methyl-6-methylidenepiperidin-2-one?
The IUPAC name of N-(1,3-dimethylideneinden-4-yl)formamide;ethane;3-methyl-6-methylidenepiperidin-2-one (CID 144735254) is N-(1,3-dimethylideneinden-4-yl)formamide;ethane;3-methyl-6-methylidenepiperidin-2-one.
What is the SMILES notation for N-(1,3-dimethylideneinden-4-yl)formamide;ethane;3-methyl-6-methylidenepiperidin-2-one?
The canonical SMILES for N-(1,3-dimethylideneinden-4-yl)formamide;ethane;3-methyl-6-methylidenepiperidin-2-one is C=C1CC(=C)c2c(NC=O)cccc21.C=C1CCC(C)C(=O)N1.CC.
What is the InChIKey of N-(1,3-dimethylideneinden-4-yl)formamide;ethane;3-methyl-6-methylidenepiperidin-2-one?
The InChIKey is SRSSOTNZFZNMOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO.C7H11NO.C2H6/c1-8-6-9(2)12-10(8)4-3-5-11(12)13-7-14;1-5-3-4-6(2)8-7(5)9;1-2/h3-5,7H,1-2,6H2,(H,13,14);5H,2-4H2,1H3,(H,8,9);1-2H3.
What are the key properties of N-(1,3-dimethylideneinden-4-yl)formamide;ethane;3-methyl-6-methylidenepiperidin-2-one?
N-(1,3-dimethylideneinden-4-yl)formamide;ethane;3-methyl-6-methylidenepiperidin-2-one has a molecular weight of 340.47 g/mol, XLogP of 4.76, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-dimethylideneinden-4-yl)formamide;ethane;3-methyl-6-methylidenepiperidin-2-one is sourced from PubChem (CID 144735254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).