About [5-bromo-3-[3-(dimethylaminosulfanyl)phenyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite
[5-bromo-3-[3-(dimethylaminosulfanyl)phenyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite (PubChem CID 144735612) has the molecular formula C15H13BrIN3S2
and a molecular weight of 506.23 g/mol. Its IUPAC name is [5-bromo-3-[3-(dimethylaminosulfanyl)phenyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite.
Molecular Properties
| Compound Name | [5-bromo-3-[3-(dimethylaminosulfanyl)phenyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite |
| PubChem CID | 144735612 |
| Molecular Formula | C15H13BrIN3S2 |
| Molecular Weight | 506.23 g/mol |
| Exact Mass | 504.88 |
| IUPAC Name | [5-bromo-3-[3-(dimethylaminosulfanyl)phenyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite |
| SMILES | CN(C)Sc1cccc(-c2cn(SI)c3ncc(Br)cc23)c1 |
| InChI | InChI=1S/C15H13BrIN3S2/c1-19(2)21-12-5-3-4-10(6-12)14-9-20(22-17)15-13(14)7-11(16)8-18-15/h3-9H,1-2H3 |
| InChIKey | DASMTHDPBQQYOC-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.23 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-bromo-3-[3-(dimethylaminosulfanyl)phenyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-bromo-3-[3-(dimethylaminosulfanyl)phenyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite?
The IUPAC name of [5-bromo-3-[3-(dimethylaminosulfanyl)phenyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite (CID 144735612) is [5-bromo-3-[3-(dimethylaminosulfanyl)phenyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite.
What is the SMILES notation for [5-bromo-3-[3-(dimethylaminosulfanyl)phenyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite?
The canonical SMILES for [5-bromo-3-[3-(dimethylaminosulfanyl)phenyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite is CN(C)Sc1cccc(-c2cn(SI)c3ncc(Br)cc23)c1.
What is the InChIKey of [5-bromo-3-[3-(dimethylaminosulfanyl)phenyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite?
The InChIKey is DASMTHDPBQQYOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13BrIN3S2/c1-19(2)21-12-5-3-4-10(6-12)14-9-20(22-17)15-13(14)7-11(16)8-18-15/h3-9H,1-2H3.
What are the key properties of [5-bromo-3-[3-(dimethylaminosulfanyl)phenyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite?
[5-bromo-3-[3-(dimethylaminosulfanyl)phenyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite has a molecular weight of 506.23 g/mol, XLogP of 5.88, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-bromo-3-[3-(dimethylaminosulfanyl)phenyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite is sourced from PubChem (CID 144735612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).