About (6E)-8-methyl-5-propan-2-ylnona-6,8-dien-2-ol
(6E)-8-methyl-5-propan-2-ylnona-6,8-dien-2-ol (PubChem CID 14473563) has the molecular formula C13H24O
and a molecular weight of 196.33 g/mol. Its IUPAC name is (6E)-8-methyl-5-propan-2-ylnona-6,8-dien-2-ol.
Molecular Properties
| Compound Name | (6E)-8-methyl-5-propan-2-ylnona-6,8-dien-2-ol |
| PubChem CID | 14473563 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (6E)-8-methyl-5-propan-2-ylnona-6,8-dien-2-ol |
| SMILES | C=C(C)/C=C/C(CCC(C)O)C(C)C |
| InChI | InChI=1S/C13H24O/c1-10(2)6-8-13(11(3)4)9-7-12(5)14/h6,8,11-14H,1,7,9H2,2-5H3/b8-6+ |
| InChIKey | KXCPAUWIRBMTET-SOFGYWHQSA-N |
| XLogP | 3.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (6E)-8-methyl-5-propan-2-ylnona-6,8-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-8-methyl-5-propan-2-ylnona-6,8-dien-2-ol?
The IUPAC name of (6E)-8-methyl-5-propan-2-ylnona-6,8-dien-2-ol (CID 14473563) is (6E)-8-methyl-5-propan-2-ylnona-6,8-dien-2-ol.
What is the SMILES notation for (6E)-8-methyl-5-propan-2-ylnona-6,8-dien-2-ol?
The canonical SMILES for (6E)-8-methyl-5-propan-2-ylnona-6,8-dien-2-ol is C=C(C)/C=C/C(CCC(C)O)C(C)C.
What is the InChIKey of (6E)-8-methyl-5-propan-2-ylnona-6,8-dien-2-ol?
The InChIKey is KXCPAUWIRBMTET-SOFGYWHQSA-N. The full InChI is InChI=1S/C13H24O/c1-10(2)6-8-13(11(3)4)9-7-12(5)14/h6,8,11-14H,1,7,9H2,2-5H3/b8-6+.
What are the key properties of (6E)-8-methyl-5-propan-2-ylnona-6,8-dien-2-ol?
(6E)-8-methyl-5-propan-2-ylnona-6,8-dien-2-ol has a molecular weight of 196.33 g/mol, XLogP of 3.55, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-8-methyl-5-propan-2-ylnona-6,8-dien-2-ol is sourced from PubChem (CID 14473563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).