C25H29Cl2N5O3 — CID 144736249
2-(3,5-dichloro-4-methoxyphenyl)-7-[2-(methylamino)phenyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbaldehyde;methanamine;prop-2-enal (PubChem CID 144736249) has the molecular formula C25H29Cl2N5O3 and a molecular weight of 518.45 g/mol. Its IUPAC name is 2-(3,5-dichloro-4-methoxyphenyl)-7-[2-(methylamino)phenyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbaldehyde;methanamine;prop-2-enal.
| Compound Name | 2-(3,5-dichloro-4-methoxyphenyl)-7-[2-(methylamino)phenyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbaldehyde;methanamine;prop-2-enal |
|---|---|
| PubChem CID | 144736249 |
| Molecular Formula | C25H29Cl2N5O3 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | 2-(3,5-dichloro-4-methoxyphenyl)-7-[2-(methylamino)phenyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbaldehyde;methanamine;prop-2-enal |
| SMILES | C=CC=O.CN.CNc1ccccc1C1CCNc2c(C=O)c(-c3cc(Cl)c(OC)c(Cl)c3)nn21 |
| InChI | InChI=1S/C21H20Cl2N4O2.C3H4O.CH5N/c1-24-17-6-4-3-5-13(17)18-7-8-25-21-14(11-28)19(26-27(18)21)12-9-15(22)20(29-2)16(23)10-12;1-2-3-4;1-2/h3-6,9-11,18,24-25H,7-8H2,1-2H3;2-3H,1H2;2H2,1H3 |
| InChIKey | YLQAPUZJZPHGSC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|