C20H32BNO6 — CID 144736347
1-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-pyridine-2,2,6,6-tetrol;ethane (PubChem CID 144736347) has the molecular formula C20H32BNO6 and a molecular weight of 393.29 g/mol. Its IUPAC name is 1-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-pyridine-2,2,6,6-tetrol;ethane.
| Compound Name | 1-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-pyridine-2,2,6,6-tetrol;ethane |
|---|---|
| PubChem CID | 144736347 |
| Molecular Formula | C20H32BNO6 |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 1-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-pyridine-2,2,6,6-tetrol;ethane |
| SMILES | CC.CC1(C)OB(C2=CC(O)(O)N(Cc3ccccc3)C(O)(O)C2)OC1(C)C |
| InChI | InChI=1S/C18H26BNO6.C2H6/c1-15(2)16(3,4)26-19(25-15)14-10-17(21,22)20(18(23,24)11-14)12-13-8-6-5-7-9-13;1-2/h5-10,21-24H,11-12H2,1-4H3;1-2H3 |
| InChIKey | HIIKBOYFIJGZGV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|