C18H30N2O — CID 144736514
3-methyl-N-(2-pyridin-2-ylethyl)cyclohexane-1-carboxamide;propane (PubChem CID 144736514) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is 3-methyl-N-(2-pyridin-2-ylethyl)cyclohexane-1-carboxamide;propane.
| Compound Name | 3-methyl-N-(2-pyridin-2-ylethyl)cyclohexane-1-carboxamide;propane |
|---|---|
| PubChem CID | 144736514 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 3-methyl-N-(2-pyridin-2-ylethyl)cyclohexane-1-carboxamide;propane |
| SMILES | CC1CCCC(C(=O)NCCc2ccccn2)C1.CCC |
| InChI | InChI=1S/C15H22N2O.C3H8/c1-12-5-4-6-13(11-12)15(18)17-10-8-14-7-2-3-9-16-14;1-3-2/h2-3,7,9,12-13H,4-6,8,10-11H2,1H3,(H,17,18);3H2,1-2H3 |
| InChIKey | MQEJXIWKHUJTPW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |