C20H24N6O — CID 144736544
4-[3-(2-aminopyrimidin-4-yl)-1-[3-(methylamino)propyl]pyrrolo[2,3-c]pyridin-5-yl]-2-methylbut-3-yn-2-ol (PubChem CID 144736544) has the molecular formula C20H24N6O and a molecular weight of 364.45 g/mol. Its IUPAC name is 4-[3-(2-aminopyrimidin-4-yl)-1-[3-(methylamino)propyl]pyrrolo[2,3-c]pyridin-5-yl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[3-(2-aminopyrimidin-4-yl)-1-[3-(methylamino)propyl]pyrrolo[2,3-c]pyridin-5-yl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 144736544 |
| Molecular Formula | C20H24N6O |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 4-[3-(2-aminopyrimidin-4-yl)-1-[3-(methylamino)propyl]pyrrolo[2,3-c]pyridin-5-yl]-2-methylbut-3-yn-2-ol |
| SMILES | CNCCCn1cc(-c2ccnc(N)n2)c2cc(C#CC(C)(C)O)ncc21 |
| InChI | InChI=1S/C20H24N6O/c1-20(2,27)7-5-14-11-15-16(17-6-9-23-19(21)25-17)13-26(10-4-8-22-3)18(15)12-24-14/h6,9,11-13,22,27H,4,8,10H2,1-3H3,(H2,21,23,25) |
| InChIKey | KZCCZFSRBRNESQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|