C33H58N4O6 — CID 144736683
3-[1-[4-[(2-aminoacetyl)-methylamino]-3-methoxy-5-methylheptanoyl]pyrrolidin-2-yl]-N-[(2R)-1-hydroxy-1-phenylpropan-2-yl]-3-methoxy-2-methylpropanamide;propane (PubChem CID 144736683) has the molecular formula C33H58N4O6 and a molecular weight of 606.85 g/mol. Its IUPAC name is 3-[1-[4-[(2-aminoacetyl)-methylamino]-3-methoxy-5-methylheptanoyl]pyrrolidin-2-yl]-N-[(2R)-1-hydroxy-1-phenylpropan-2-yl]-3-methoxy-2-methylpropanamide;propane.
| Compound Name | 3-[1-[4-[(2-aminoacetyl)-methylamino]-3-methoxy-5-methylheptanoyl]pyrrolidin-2-yl]-N-[(2R)-1-hydroxy-1-phenylpropan-2-yl]-3-methoxy-2-methylpropanamide;propane |
|---|---|
| PubChem CID | 144736683 |
| Molecular Formula | C33H58N4O6 |
| Molecular Weight | 606.85 g/mol |
| Exact Mass | 606.44 |
| IUPAC Name | 3-[1-[4-[(2-aminoacetyl)-methylamino]-3-methoxy-5-methylheptanoyl]pyrrolidin-2-yl]-N-[(2R)-1-hydroxy-1-phenylpropan-2-yl]-3-methoxy-2-methylpropanamide;propane |
| SMILES | CCC.CCC(C)C(C(CC(=O)N1CCCC1C(OC)C(C)C(=O)N[C@H](C)C(O)c1ccccc1)OC)N(C)C(=O)CN |
| InChI | InChI=1S/C30H50N4O6.C3H8/c1-8-19(2)27(33(5)26(36)18-31)24(39-6)17-25(35)34-16-12-15-23(34)29(40-7)20(3)30(38)32-21(4)28(37)22-13-10-9-11-14-22;1-3-2/h9-11,13-14,19-21,23-24,27-29,37H,8,12,15-18,31H2,1-7H3,(H,32,38);3H2,1-2H3/t19?,20?,21-,23?,24?,27?,28?,29?;/m1./s1 |
| InChIKey | YVKRASLVNOFATM-PCCVNHKNSA-N |
| XLogP | 3.52 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.85 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |