C25H27F4N7O2 — CID 144738752
(2E)-N-[(5R)-5-(3-fluorophenyl)-1-(3-methylimidazo[1,2-b]pyridazin-6-yl)pyrrolidin-3-yl]-2-[1-(methylamino)ethylidene]-N'-(2,2,2-trifluoroethyl)propanediamide (PubChem CID 144738752) has the molecular formula C25H27F4N7O2 and a molecular weight of 533.53 g/mol. Its IUPAC name is (2E)-N-[(5R)-5-(3-fluorophenyl)-1-(3-methylimidazo[1,2-b]pyridazin-6-yl)pyrrolidin-3-yl]-2-[1-(methylamino)ethylidene]-N'-(2,2,2-trifluoroethyl)propanediamide.
| Compound Name | (2E)-N-[(5R)-5-(3-fluorophenyl)-1-(3-methylimidazo[1,2-b]pyridazin-6-yl)pyrrolidin-3-yl]-2-[1-(methylamino)ethylidene]-N'-(2,2,2-trifluoroethyl)propanediamide |
|---|---|
| PubChem CID | 144738752 |
| Molecular Formula | C25H27F4N7O2 |
| Molecular Weight | 533.53 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | (2E)-N-[(5R)-5-(3-fluorophenyl)-1-(3-methylimidazo[1,2-b]pyridazin-6-yl)pyrrolidin-3-yl]-2-[1-(methylamino)ethylidene]-N'-(2,2,2-trifluoroethyl)propanediamide |
| SMILES | CN/C(C)=C(\C(=O)NCC(F)(F)F)C(=O)NC1C[C@H](c2cccc(F)c2)N(c2ccc3ncc(C)n3n2)C1 |
| InChI | InChI=1S/C25H27F4N7O2/c1-14-11-31-20-7-8-21(34-36(14)20)35-12-18(10-19(35)16-5-4-6-17(26)9-16)33-24(38)22(15(2)30-3)23(37)32-13-25(27,28)29/h4-9,11,18-19,30H,10,12-13H2,1-3H3,(H,32,37)(H,33,38)/b22-15+/t18?,19-/m1/s1 |
| InChIKey | SZYJATYCTBZEDI-SCKLZBMNSA-N |
| XLogP | 2.78 |
| TPSA | 103.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.53 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|