C24H28N4O3 — CID 144739473
[3-[3-(2-hydroxybutan-2-yl)phenoxy]piperidin-1-yl]-[2-(triazol-2-yl)phenyl]methanone (PubChem CID 144739473) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is [3-[3-(2-hydroxybutan-2-yl)phenoxy]piperidin-1-yl]-[2-(triazol-2-yl)phenyl]methanone.
| Compound Name | [3-[3-(2-hydroxybutan-2-yl)phenoxy]piperidin-1-yl]-[2-(triazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 144739473 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | [3-[3-(2-hydroxybutan-2-yl)phenoxy]piperidin-1-yl]-[2-(triazol-2-yl)phenyl]methanone |
| SMILES | CCC(C)(O)c1cccc(OC2CCCN(C(=O)c3ccccc3-n3nccn3)C2)c1 |
| InChI | InChI=1S/C24H28N4O3/c1-3-24(2,30)18-8-6-9-19(16-18)31-20-10-7-15-27(17-20)23(29)21-11-4-5-12-22(21)28-25-13-14-26-28/h4-6,8-9,11-14,16,20,30H,3,7,10,15,17H2,1-2H3 |
| InChIKey | XTGIXTNNJREAKO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |