C21H30ClN5 — CID 144740164
1-[2-chloro-6-[[(1Z)-1-[(Z)-ethylideneamino]buta-1,3-dienyl]amino]pyrimidin-4-yl]cyclooctane-1-carbonitrile;ethane (PubChem CID 144740164) has the molecular formula C21H30ClN5 and a molecular weight of 387.96 g/mol. Its IUPAC name is 1-[2-chloro-6-[[(1Z)-1-[(Z)-ethylideneamino]buta-1,3-dienyl]amino]pyrimidin-4-yl]cyclooctane-1-carbonitrile;ethane.
| Compound Name | 1-[2-chloro-6-[[(1Z)-1-[(Z)-ethylideneamino]buta-1,3-dienyl]amino]pyrimidin-4-yl]cyclooctane-1-carbonitrile;ethane |
|---|---|
| PubChem CID | 144740164 |
| Molecular Formula | C21H30ClN5 |
| Molecular Weight | 387.96 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 1-[2-chloro-6-[[(1Z)-1-[(Z)-ethylideneamino]buta-1,3-dienyl]amino]pyrimidin-4-yl]cyclooctane-1-carbonitrile;ethane |
| SMILES | C=C/C=C(\N=C/C)Nc1cc(C2(C#N)CCCCCCC2)nc(Cl)n1.CC |
| InChI | InChI=1S/C19H24ClN5.C2H6/c1-3-10-16(22-4-2)24-17-13-15(23-18(20)25-17)19(14-21)11-8-6-5-7-9-12-19;1-2/h3-4,10,13H,1,5-9,11-12H2,2H3,(H,23,24,25);1-2H3/b16-10+,22-4-; |
| InChIKey | MLYPVFFIUMWNTR-UQUMHYNISA-N |
| XLogP | 6.19 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.96 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|