C14H28O6 — CID 144740302
2-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-4,4-dimethoxybutan-2-yl]oxypropan-2-ol (PubChem CID 144740302) has the molecular formula C14H28O6 and a molecular weight of 292.37 g/mol. Its IUPAC name is 2-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-4,4-dimethoxybutan-2-yl]oxypropan-2-ol.
| Compound Name | 2-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-4,4-dimethoxybutan-2-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 144740302 |
| Molecular Formula | C14H28O6 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-4,4-dimethoxybutan-2-yl]oxypropan-2-ol |
| SMILES | COC(CC(CC1COC(C)(C)O1)OC(C)(C)O)OC |
| InChI | InChI=1S/C14H28O6/c1-13(2,15)19-10(8-12(16-5)17-6)7-11-9-18-14(3,4)20-11/h10-12,15H,7-9H2,1-6H3 |
| InChIKey | BRIOFTDDYXWKKD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|