C11H16FNO — CID 144740320
N-[(Z,3E)-2-fluoro-3-prop-2-enylidenehept-4-enyl]formamide (PubChem CID 144740320) has the molecular formula C11H16FNO and a molecular weight of 197.25 g/mol. Its IUPAC name is N-[(Z,3E)-2-fluoro-3-prop-2-enylidenehept-4-enyl]formamide.
| Compound Name | N-[(Z,3E)-2-fluoro-3-prop-2-enylidenehept-4-enyl]formamide |
|---|---|
| PubChem CID | 144740320 |
| Molecular Formula | C11H16FNO |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N-[(Z,3E)-2-fluoro-3-prop-2-enylidenehept-4-enyl]formamide |
| SMILES | C=C/C=C(\C=C/CC)C(F)CNC=O |
| InChI | InChI=1S/C11H16FNO/c1-3-5-7-10(6-4-2)11(12)8-13-9-14/h4-7,9,11H,2-3,8H2,1H3,(H,13,14)/b7-5-,10-6+ |
| InChIKey | YEXOVLWRFGAWNS-ZPRNNRRZSA-N |
| XLogP | 2.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|