C27H48O3 — CID 144740749
(1-methylcyclopentyl) 2-[5-(6-ethyl-2,2,6-trimethyloctan-3-yl)cyclohex-2-en-1-yl]oxyacetate (PubChem CID 144740749) has the molecular formula C27H48O3 and a molecular weight of 420.68 g/mol. Its IUPAC name is (1-methylcyclopentyl) 2-[5-(6-ethyl-2,2,6-trimethyloctan-3-yl)cyclohex-2-en-1-yl]oxyacetate.
| Compound Name | (1-methylcyclopentyl) 2-[5-(6-ethyl-2,2,6-trimethyloctan-3-yl)cyclohex-2-en-1-yl]oxyacetate |
|---|---|
| PubChem CID | 144740749 |
| Molecular Formula | C27H48O3 |
| Molecular Weight | 420.68 g/mol |
| Exact Mass | 420.36 |
| IUPAC Name | (1-methylcyclopentyl) 2-[5-(6-ethyl-2,2,6-trimethyloctan-3-yl)cyclohex-2-en-1-yl]oxyacetate |
| SMILES | CCC(C)(CC)CCC(C1CC=CC(OCC(=O)OC2(C)CCCC2)C1)C(C)(C)C |
| InChI | InChI=1S/C27H48O3/c1-8-26(6,9-2)18-15-23(25(3,4)5)21-13-12-14-22(19-21)29-20-24(28)30-27(7)16-10-11-17-27/h12,14,21-23H,8-11,13,15-20H2,1-7H3 |
| InChIKey | VNLSJZOQHIJENJ-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.68 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|