About 4-[[4-[5,6-bis(ethenyl)-3-pyridinyl]-2-fluorophenyl]methyl]pyrido[2,3-b]pyrazin-3-one
4-[[4-[5,6-bis(ethenyl)-3-pyridinyl]-2-fluorophenyl]methyl]pyrido[2,3-b]pyrazin-3-one (PubChem CID 144741976) has the molecular formula C23H17FN4O
and a molecular weight of 384.41 g/mol. Its IUPAC name is 4-[[4-[5,6-bis(ethenyl)-3-pyridinyl]-2-fluorophenyl]methyl]pyrido[2,3-b]pyrazin-3-one.
Molecular Properties
| Compound Name | 4-[[4-[5,6-bis(ethenyl)-3-pyridinyl]-2-fluorophenyl]methyl]pyrido[2,3-b]pyrazin-3-one |
| PubChem CID | 144741976 |
| Molecular Formula | C23H17FN4O |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 4-[[4-[5,6-bis(ethenyl)-3-pyridinyl]-2-fluorophenyl]methyl]pyrido[2,3-b]pyrazin-3-one |
| SMILES | C=Cc1cc(-c2ccc(Cn3c(=O)cnc4cccnc43)c(F)c2)cnc1C=C |
| InChI | InChI=1S/C23H17FN4O/c1-3-15-10-18(12-26-20(15)4-2)16-7-8-17(19(24)11-16)14-28-22(29)13-27-21-6-5-9-25-23(21)28/h3-13H,1-2,14H2 |
| InChIKey | OOEJHXFWGJRARH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[4-[5,6-bis(ethenyl)-3-pyridinyl]-2-fluorophenyl]methyl]pyrido[2,3-b]pyrazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-[5,6-bis(ethenyl)-3-pyridinyl]-2-fluorophenyl]methyl]pyrido[2,3-b]pyrazin-3-one?
The IUPAC name of 4-[[4-[5,6-bis(ethenyl)-3-pyridinyl]-2-fluorophenyl]methyl]pyrido[2,3-b]pyrazin-3-one (CID 144741976) is 4-[[4-[5,6-bis(ethenyl)-3-pyridinyl]-2-fluorophenyl]methyl]pyrido[2,3-b]pyrazin-3-one.
What is the SMILES notation for 4-[[4-[5,6-bis(ethenyl)-3-pyridinyl]-2-fluorophenyl]methyl]pyrido[2,3-b]pyrazin-3-one?
The canonical SMILES for 4-[[4-[5,6-bis(ethenyl)-3-pyridinyl]-2-fluorophenyl]methyl]pyrido[2,3-b]pyrazin-3-one is C=Cc1cc(-c2ccc(Cn3c(=O)cnc4cccnc43)c(F)c2)cnc1C=C.
What is the InChIKey of 4-[[4-[5,6-bis(ethenyl)-3-pyridinyl]-2-fluorophenyl]methyl]pyrido[2,3-b]pyrazin-3-one?
The InChIKey is OOEJHXFWGJRARH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17FN4O/c1-3-15-10-18(12-26-20(15)4-2)16-7-8-17(19(24)11-16)14-28-22(29)13-27-21-6-5-9-25-23(21)28/h3-13H,1-2,14H2.
What are the key properties of 4-[[4-[5,6-bis(ethenyl)-3-pyridinyl]-2-fluorophenyl]methyl]pyrido[2,3-b]pyrazin-3-one?
4-[[4-[5,6-bis(ethenyl)-3-pyridinyl]-2-fluorophenyl]methyl]pyrido[2,3-b]pyrazin-3-one has a molecular weight of 384.41 g/mol, XLogP of 4.33, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-[5,6-bis(ethenyl)-3-pyridinyl]-2-fluorophenyl]methyl]pyrido[2,3-b]pyrazin-3-one is sourced from PubChem (CID 144741976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).