About 1-[[2,6-difluoro-4-(1H-indazol-6-yl)phenyl]methyl]quinoxalin-2-one;molecular hydrogen
1-[[2,6-difluoro-4-(1H-indazol-6-yl)phenyl]methyl]quinoxalin-2-one;molecular hydrogen (PubChem CID 144741980) has the molecular formula C22H16F2N4O
and a molecular weight of 390.39 g/mol. Its IUPAC name is 1-[[2,6-difluoro-4-(1H-indazol-6-yl)phenyl]methyl]quinoxalin-2-one;molecular hydrogen.
Molecular Properties
| Compound Name | 1-[[2,6-difluoro-4-(1H-indazol-6-yl)phenyl]methyl]quinoxalin-2-one;molecular hydrogen |
| PubChem CID | 144741980 |
| Molecular Formula | C22H16F2N4O |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 1-[[2,6-difluoro-4-(1H-indazol-6-yl)phenyl]methyl]quinoxalin-2-one;molecular hydrogen |
| SMILES | O=c1cnc2ccccc2n1Cc1c(F)cc(-c2ccc3cn[nH]c3c2)cc1F.[H][H] |
| InChI | InChI=1S/C22H14F2N4O.H2/c23-17-7-15(13-5-6-14-10-26-27-20(14)9-13)8-18(24)16(17)12-28-21-4-2-1-3-19(21)25-11-22(28)29;/h1-11H,12H2,(H,26,27);1H |
| InChIKey | DXFOQNPNGZQWIV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[2,6-difluoro-4-(1H-indazol-6-yl)phenyl]methyl]quinoxalin-2-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2,6-difluoro-4-(1H-indazol-6-yl)phenyl]methyl]quinoxalin-2-one;molecular hydrogen?
The IUPAC name of 1-[[2,6-difluoro-4-(1H-indazol-6-yl)phenyl]methyl]quinoxalin-2-one;molecular hydrogen (CID 144741980) is 1-[[2,6-difluoro-4-(1H-indazol-6-yl)phenyl]methyl]quinoxalin-2-one;molecular hydrogen.
What is the SMILES notation for 1-[[2,6-difluoro-4-(1H-indazol-6-yl)phenyl]methyl]quinoxalin-2-one;molecular hydrogen?
The canonical SMILES for 1-[[2,6-difluoro-4-(1H-indazol-6-yl)phenyl]methyl]quinoxalin-2-one;molecular hydrogen is O=c1cnc2ccccc2n1Cc1c(F)cc(-c2ccc3cn[nH]c3c2)cc1F.[H][H].
What is the InChIKey of 1-[[2,6-difluoro-4-(1H-indazol-6-yl)phenyl]methyl]quinoxalin-2-one;molecular hydrogen?
The InChIKey is DXFOQNPNGZQWIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14F2N4O.H2/c23-17-7-15(13-5-6-14-10-26-27-20(14)9-13)8-18(24)16(17)12-28-21-4-2-1-3-19(21)25-11-22(28)29;/h1-11H,12H2,(H,26,27);1H.
What are the key properties of 1-[[2,6-difluoro-4-(1H-indazol-6-yl)phenyl]methyl]quinoxalin-2-one;molecular hydrogen?
1-[[2,6-difluoro-4-(1H-indazol-6-yl)phenyl]methyl]quinoxalin-2-one;molecular hydrogen has a molecular weight of 390.39 g/mol, XLogP of 4.51, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2,6-difluoro-4-(1H-indazol-6-yl)phenyl]methyl]quinoxalin-2-one;molecular hydrogen is sourced from PubChem (CID 144741980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).