C18H30O — CID 144742858
1-butan-2-yl-3-(1-cyclopropylethyl)-2-methoxybenzene;ethane (PubChem CID 144742858) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is 1-butan-2-yl-3-(1-cyclopropylethyl)-2-methoxybenzene;ethane.
| Compound Name | 1-butan-2-yl-3-(1-cyclopropylethyl)-2-methoxybenzene;ethane |
|---|---|
| PubChem CID | 144742858 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 1-butan-2-yl-3-(1-cyclopropylethyl)-2-methoxybenzene;ethane |
| SMILES | CC.CCC(C)c1cccc(C(C)C2CC2)c1OC |
| InChI | InChI=1S/C16H24O.C2H6/c1-5-11(2)14-7-6-8-15(16(14)17-4)12(3)13-9-10-13;1-2/h6-8,11-13H,5,9-10H2,1-4H3;1-2H3 |
| InChIKey | MCTRRAZKKHWUPB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |