C28H32N6O3 — CID 144743062
(24Z,28E,32E)-6,11,18-trioxa-1,13,23,30,31,33-hexazahexacyclo[22.7.2.22,5.219,22.010,12.029,32]heptatriaconta-2(37),3,5(36),19(35),20,22(34),24,28,30,32-decaene (PubChem CID 144743062) has the molecular formula C28H32N6O3 and a molecular weight of 500.60 g/mol. Its IUPAC name is (24Z,28E,32E)-6,11,18-trioxa-1,13,23,30,31,33-hexazahexacyclo[22.7.2.22,5.219,22.010,12.029,32]heptatriaconta-2(37),3,5(36),19(35),20,22(34),24,28,30,32-decaene.
| Compound Name | (24Z,28E,32E)-6,11,18-trioxa-1,13,23,30,31,33-hexazahexacyclo[22.7.2.22,5.219,22.010,12.029,32]heptatriaconta-2(37),3,5(36),19(35),20,22(34),24,28,30,32-decaene |
|---|---|
| PubChem CID | 144743062 |
| Molecular Formula | C28H32N6O3 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | (24Z,28E,32E)-6,11,18-trioxa-1,13,23,30,31,33-hexazahexacyclo[22.7.2.22,5.219,22.010,12.029,32]heptatriaconta-2(37),3,5(36),19(35),20,22(34),24,28,30,32-decaene |
| SMILES | C1=C2\N=c3/c(nnn3-c3ccc(cc3)OCCCC3OC3NCCCCOc3ccc(cc3)N2)=C\CC/1 |
| InChI | InChI=1S/C28H32N6O3/c1-2-8-26-30-20-9-13-22(14-10-20)35-18-4-3-17-29-28-25(37-28)7-5-19-36-23-15-11-21(12-16-23)34-27(31-26)24(6-1)32-33-34/h6,8-16,25,28-30H,1-5,7,17-19H2/b24-6+,26-8-,31-27+ |
| InChIKey | RCOXSVDCGLMJHC-PRYARTPVSA-N |
| XLogP | 3.06 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|