About (5Z)-3-(3,3-difluorocyclobutyl)-5-(pyridin-4-ylmethylidene)imidazolidine-2,4-dione;ethane
(5Z)-3-(3,3-difluorocyclobutyl)-5-(pyridin-4-ylmethylidene)imidazolidine-2,4-dione;ethane (PubChem CID 144743088) has the molecular formula C15H17F2N3O2
and a molecular weight of 309.32 g/mol. Its IUPAC name is (5Z)-3-(3,3-difluorocyclobutyl)-5-(pyridin-4-ylmethylidene)imidazolidine-2,4-dione;ethane.
Molecular Properties
| Compound Name | (5Z)-3-(3,3-difluorocyclobutyl)-5-(pyridin-4-ylmethylidene)imidazolidine-2,4-dione;ethane |
| PubChem CID | 144743088 |
| Molecular Formula | C15H17F2N3O2 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (5Z)-3-(3,3-difluorocyclobutyl)-5-(pyridin-4-ylmethylidene)imidazolidine-2,4-dione;ethane |
| SMILES | CC.O=C1N/C(=C\c2ccncc2)C(=O)N1C1CC(F)(F)C1 |
| InChI | InChI=1S/C13H11F2N3O2.C2H6/c14-13(15)6-9(7-13)18-11(19)10(17-12(18)20)5-8-1-3-16-4-2-8;1-2/h1-5,9H,6-7H2,(H,17,20);1-2H3/b10-5-; |
| InChIKey | CQNJCZAQQGSWKU-WIMVAJRLSA-N |
| XLogP | 2.80 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-3-(3,3-difluorocyclobutyl)-5-(pyridin-4-ylmethylidene)imidazolidine-2,4-dione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-3-(3,3-difluorocyclobutyl)-5-(pyridin-4-ylmethylidene)imidazolidine-2,4-dione;ethane?
The IUPAC name of (5Z)-3-(3,3-difluorocyclobutyl)-5-(pyridin-4-ylmethylidene)imidazolidine-2,4-dione;ethane (CID 144743088) is (5Z)-3-(3,3-difluorocyclobutyl)-5-(pyridin-4-ylmethylidene)imidazolidine-2,4-dione;ethane.
What is the SMILES notation for (5Z)-3-(3,3-difluorocyclobutyl)-5-(pyridin-4-ylmethylidene)imidazolidine-2,4-dione;ethane?
The canonical SMILES for (5Z)-3-(3,3-difluorocyclobutyl)-5-(pyridin-4-ylmethylidene)imidazolidine-2,4-dione;ethane is CC.O=C1N/C(=C\c2ccncc2)C(=O)N1C1CC(F)(F)C1.
What is the InChIKey of (5Z)-3-(3,3-difluorocyclobutyl)-5-(pyridin-4-ylmethylidene)imidazolidine-2,4-dione;ethane?
The InChIKey is CQNJCZAQQGSWKU-WIMVAJRLSA-N. The full InChI is InChI=1S/C13H11F2N3O2.C2H6/c14-13(15)6-9(7-13)18-11(19)10(17-12(18)20)5-8-1-3-16-4-2-8;1-2/h1-5,9H,6-7H2,(H,17,20);1-2H3/b10-5-;.
What are the key properties of (5Z)-3-(3,3-difluorocyclobutyl)-5-(pyridin-4-ylmethylidene)imidazolidine-2,4-dione;ethane?
(5Z)-3-(3,3-difluorocyclobutyl)-5-(pyridin-4-ylmethylidene)imidazolidine-2,4-dione;ethane has a molecular weight of 309.32 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-3-(3,3-difluorocyclobutyl)-5-(pyridin-4-ylmethylidene)imidazolidine-2,4-dione;ethane is sourced from PubChem (CID 144743088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).