About 4-carbamoyl-5-(1H-pyrazole-5-carbonylamino)thiophene-2-sulfonyl chloride;ethane
4-carbamoyl-5-(1H-pyrazole-5-carbonylamino)thiophene-2-sulfonyl chloride;ethane (PubChem CID 144743143) has the molecular formula C11H13ClN4O4S2
and a molecular weight of 364.84 g/mol. Its IUPAC name is 4-carbamoyl-5-(1H-pyrazole-5-carbonylamino)thiophene-2-sulfonyl chloride;ethane.
Molecular Properties
| Compound Name | 4-carbamoyl-5-(1H-pyrazole-5-carbonylamino)thiophene-2-sulfonyl chloride;ethane |
| PubChem CID | 144743143 |
| Molecular Formula | C11H13ClN4O4S2 |
| Molecular Weight | 364.84 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 4-carbamoyl-5-(1H-pyrazole-5-carbonylamino)thiophene-2-sulfonyl chloride;ethane |
| SMILES | CC.NC(=O)c1cc(S(=O)(=O)Cl)sc1NC(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C9H7ClN4O4S2.C2H6/c10-20(17,18)6-3-4(7(11)15)9(19-6)13-8(16)5-1-2-12-14-5;1-2/h1-3H,(H2,11,15)(H,12,14)(H,13,16);1-2H3 |
| InChIKey | UGHBNLYKPBIFJY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 135.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.84 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-carbamoyl-5-(1H-pyrazole-5-carbonylamino)thiophene-2-sulfonyl chloride;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-carbamoyl-5-(1H-pyrazole-5-carbonylamino)thiophene-2-sulfonyl chloride;ethane?
The IUPAC name of 4-carbamoyl-5-(1H-pyrazole-5-carbonylamino)thiophene-2-sulfonyl chloride;ethane (CID 144743143) is 4-carbamoyl-5-(1H-pyrazole-5-carbonylamino)thiophene-2-sulfonyl chloride;ethane.
What is the SMILES notation for 4-carbamoyl-5-(1H-pyrazole-5-carbonylamino)thiophene-2-sulfonyl chloride;ethane?
The canonical SMILES for 4-carbamoyl-5-(1H-pyrazole-5-carbonylamino)thiophene-2-sulfonyl chloride;ethane is CC.NC(=O)c1cc(S(=O)(=O)Cl)sc1NC(=O)c1ccn[nH]1.
What is the InChIKey of 4-carbamoyl-5-(1H-pyrazole-5-carbonylamino)thiophene-2-sulfonyl chloride;ethane?
The InChIKey is UGHBNLYKPBIFJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN4O4S2.C2H6/c10-20(17,18)6-3-4(7(11)15)9(19-6)13-8(16)5-1-2-12-14-5;1-2/h1-3H,(H2,11,15)(H,12,14)(H,13,16);1-2H3.
What are the key properties of 4-carbamoyl-5-(1H-pyrazole-5-carbonylamino)thiophene-2-sulfonyl chloride;ethane?
4-carbamoyl-5-(1H-pyrazole-5-carbonylamino)thiophene-2-sulfonyl chloride;ethane has a molecular weight of 364.84 g/mol, XLogP of 1.78, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-carbamoyl-5-(1H-pyrazole-5-carbonylamino)thiophene-2-sulfonyl chloride;ethane is sourced from PubChem (CID 144743143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).