About N-[(1R)-5-fluoro-2,3-dihydro-1H-inden-1-yl]-N-methylbenzamide
N-[(1R)-5-fluoro-2,3-dihydro-1H-inden-1-yl]-N-methylbenzamide (PubChem CID 144743792) has the molecular formula C17H16FNO
and a molecular weight of 269.32 g/mol. Its IUPAC name is N-[(1R)-5-fluoro-2,3-dihydro-1H-inden-1-yl]-N-methylbenzamide.
Molecular Properties
| Compound Name | N-[(1R)-5-fluoro-2,3-dihydro-1H-inden-1-yl]-N-methylbenzamide |
| PubChem CID | 144743792 |
| Molecular Formula | C17H16FNO |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-[(1R)-5-fluoro-2,3-dihydro-1H-inden-1-yl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccccc1)[C@@H]1CCc2cc(F)ccc21 |
| InChI | InChI=1S/C17H16FNO/c1-19(17(20)12-5-3-2-4-6-12)16-10-7-13-11-14(18)8-9-15(13)16/h2-6,8-9,11,16H,7,10H2,1H3/t16-/m1/s1 |
| InChIKey | KESHQFRRHKUKOU-MRXNPFEDSA-N |
| XLogP | 3.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(1R)-5-fluoro-2,3-dihydro-1H-inden-1-yl]-N-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-5-fluoro-2,3-dihydro-1H-inden-1-yl]-N-methylbenzamide?
The IUPAC name of N-[(1R)-5-fluoro-2,3-dihydro-1H-inden-1-yl]-N-methylbenzamide (CID 144743792) is N-[(1R)-5-fluoro-2,3-dihydro-1H-inden-1-yl]-N-methylbenzamide.
What is the SMILES notation for N-[(1R)-5-fluoro-2,3-dihydro-1H-inden-1-yl]-N-methylbenzamide?
The canonical SMILES for N-[(1R)-5-fluoro-2,3-dihydro-1H-inden-1-yl]-N-methylbenzamide is CN(C(=O)c1ccccc1)[C@@H]1CCc2cc(F)ccc21.
What is the InChIKey of N-[(1R)-5-fluoro-2,3-dihydro-1H-inden-1-yl]-N-methylbenzamide?
The InChIKey is KESHQFRRHKUKOU-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H16FNO/c1-19(17(20)12-5-3-2-4-6-12)16-10-7-13-11-14(18)8-9-15(13)16/h2-6,8-9,11,16H,7,10H2,1H3/t16-/m1/s1.
What are the key properties of N-[(1R)-5-fluoro-2,3-dihydro-1H-inden-1-yl]-N-methylbenzamide?
N-[(1R)-5-fluoro-2,3-dihydro-1H-inden-1-yl]-N-methylbenzamide has a molecular weight of 269.32 g/mol, XLogP of 3.59, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-5-fluoro-2,3-dihydro-1H-inden-1-yl]-N-methylbenzamide is sourced from PubChem (CID 144743792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).