About ethyl 7-amino-5-morpholin-4-ylcyclohepta-1,4,6-triene-1-carboxylate
ethyl 7-amino-5-morpholin-4-ylcyclohepta-1,4,6-triene-1-carboxylate (PubChem CID 144744843) has the molecular formula C14H20N2O3
and a molecular weight of 264.32 g/mol. Its IUPAC name is ethyl 7-amino-5-morpholin-4-ylcyclohepta-1,4,6-triene-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-amino-5-morpholin-4-ylcyclohepta-1,4,6-triene-1-carboxylate |
| PubChem CID | 144744843 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | ethyl 7-amino-5-morpholin-4-ylcyclohepta-1,4,6-triene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCC=C(N2CCOCC2)C=C1N |
| InChI | InChI=1S/C14H20N2O3/c1-2-19-14(17)12-5-3-4-11(10-13(12)15)16-6-8-18-9-7-16/h4-5,10H,2-3,6-9,15H2,1H3 |
| InChIKey | UBGGEDDUQJGKDQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 7-amino-5-morpholin-4-ylcyclohepta-1,4,6-triene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-amino-5-morpholin-4-ylcyclohepta-1,4,6-triene-1-carboxylate?
The IUPAC name of ethyl 7-amino-5-morpholin-4-ylcyclohepta-1,4,6-triene-1-carboxylate (CID 144744843) is ethyl 7-amino-5-morpholin-4-ylcyclohepta-1,4,6-triene-1-carboxylate.
What is the SMILES notation for ethyl 7-amino-5-morpholin-4-ylcyclohepta-1,4,6-triene-1-carboxylate?
The canonical SMILES for ethyl 7-amino-5-morpholin-4-ylcyclohepta-1,4,6-triene-1-carboxylate is CCOC(=O)C1=CCC=C(N2CCOCC2)C=C1N.
What is the InChIKey of ethyl 7-amino-5-morpholin-4-ylcyclohepta-1,4,6-triene-1-carboxylate?
The InChIKey is UBGGEDDUQJGKDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3/c1-2-19-14(17)12-5-3-4-11(10-13(12)15)16-6-8-18-9-7-16/h4-5,10H,2-3,6-9,15H2,1H3.
What are the key properties of ethyl 7-amino-5-morpholin-4-ylcyclohepta-1,4,6-triene-1-carboxylate?
ethyl 7-amino-5-morpholin-4-ylcyclohepta-1,4,6-triene-1-carboxylate has a molecular weight of 264.32 g/mol, XLogP of 0.94, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-amino-5-morpholin-4-ylcyclohepta-1,4,6-triene-1-carboxylate is sourced from PubChem (CID 144744843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).