About 6-amino-3H-thieno[3,2-d]pyrimidin-4-one;oxepane
6-amino-3H-thieno[3,2-d]pyrimidin-4-one;oxepane (PubChem CID 144744924) has the molecular formula C12H17N3O2S
and a molecular weight of 267.35 g/mol. Its IUPAC name is 6-amino-3H-thieno[3,2-d]pyrimidin-4-one;oxepane.
Molecular Properties
| Compound Name | 6-amino-3H-thieno[3,2-d]pyrimidin-4-one;oxepane |
| PubChem CID | 144744924 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 6-amino-3H-thieno[3,2-d]pyrimidin-4-one;oxepane |
| SMILES | C1CCCOCC1.Nc1cc2nc[nH]c(=O)c2s1 |
| InChI | InChI=1S/C6H5N3OS.C6H12O/c7-4-1-3-5(11-4)6(10)9-2-8-3;1-2-4-6-7-5-3-1/h1-2H,7H2,(H,8,9,10);1-6H2 |
| InChIKey | HDCXWUBHUQEVHF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-amino-3H-thieno[3,2-d]pyrimidin-4-one;oxepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3H-thieno[3,2-d]pyrimidin-4-one;oxepane?
The IUPAC name of 6-amino-3H-thieno[3,2-d]pyrimidin-4-one;oxepane (CID 144744924) is 6-amino-3H-thieno[3,2-d]pyrimidin-4-one;oxepane.
What is the SMILES notation for 6-amino-3H-thieno[3,2-d]pyrimidin-4-one;oxepane?
The canonical SMILES for 6-amino-3H-thieno[3,2-d]pyrimidin-4-one;oxepane is C1CCCOCC1.Nc1cc2nc[nH]c(=O)c2s1.
What is the InChIKey of 6-amino-3H-thieno[3,2-d]pyrimidin-4-one;oxepane?
The InChIKey is HDCXWUBHUQEVHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3OS.C6H12O/c7-4-1-3-5(11-4)6(10)9-2-8-3;1-2-4-6-7-5-3-1/h1-2H,7H2,(H,8,9,10);1-6H2.
What are the key properties of 6-amino-3H-thieno[3,2-d]pyrimidin-4-one;oxepane?
6-amino-3H-thieno[3,2-d]pyrimidin-4-one;oxepane has a molecular weight of 267.35 g/mol, XLogP of 2.14, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3H-thieno[3,2-d]pyrimidin-4-one;oxepane is sourced from PubChem (CID 144744924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).