About CID 144745126
CID 144745126 (PubChem CID 144745126) has the molecular formula C22H24ClN4O2S+
and a molecular weight of 443.98 g/mol.
Molecular Properties
| Compound Name | CID 144745126 |
| PubChem CID | 144745126 |
| Molecular Formula | C22H24ClN4O2S+ |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | — |
| SMILES | CN(C)[SH+](=O)CCn1c(CN2C(=O)C3(CC3)c3ccncc32)cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C22H23ClN4O2S/c1-25(2)30(29)10-9-26-17(12-15-11-16(23)3-4-19(15)26)14-27-20-13-24-8-5-18(20)22(6-7-22)21(27)28/h3-5,8,11-13H,6-7,9-10,14H2,1-2H3/p+1 |
| InChIKey | XEJWVBPDIJGQKY-UHFFFAOYSA-O |
| XLogP | 3.44 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 144745126 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 144745126?
The IUPAC name of CID 144745126 (CID 144745126) is not available.
What is the SMILES notation for CID 144745126?
The canonical SMILES for CID 144745126 is CN(C)[SH+](=O)CCn1c(CN2C(=O)C3(CC3)c3ccncc32)cc2cc(Cl)ccc21.
What is the InChIKey of CID 144745126?
The InChIKey is XEJWVBPDIJGQKY-UHFFFAOYSA-O. The full InChI is InChI=1S/C22H23ClN4O2S/c1-25(2)30(29)10-9-26-17(12-15-11-16(23)3-4-19(15)26)14-27-20-13-24-8-5-18(20)22(6-7-22)21(27)28/h3-5,8,11-13H,6-7,9-10,14H2,1-2H3/p+1.
What are the key properties of CID 144745126?
CID 144745126 has a molecular weight of 443.98 g/mol, XLogP of 3.44, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 144745126 is sourced from PubChem (CID 144745126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).