About N-[3-methyl-1-(methylamino)-1-oxobutan-2-yl]cyclohexa-1,5-diene-1-carboxamide
N-[3-methyl-1-(methylamino)-1-oxobutan-2-yl]cyclohexa-1,5-diene-1-carboxamide (PubChem CID 144745229) has the molecular formula C13H20N2O2
and a molecular weight of 236.31 g/mol. Its IUPAC name is N-[3-methyl-1-(methylamino)-1-oxobutan-2-yl]cyclohexa-1,5-diene-1-carboxamide.
Molecular Properties
| Compound Name | N-[3-methyl-1-(methylamino)-1-oxobutan-2-yl]cyclohexa-1,5-diene-1-carboxamide |
| PubChem CID | 144745229 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | N-[3-methyl-1-(methylamino)-1-oxobutan-2-yl]cyclohexa-1,5-diene-1-carboxamide |
| SMILES | CNC(=O)C(NC(=O)C1=CCCC=C1)C(C)C |
| InChI | InChI=1S/C13H20N2O2/c1-9(2)11(13(17)14-3)15-12(16)10-7-5-4-6-8-10/h5,7-9,11H,4,6H2,1-3H3,(H,14,17)(H,15,16) |
| InChIKey | QQRYPJOSTYTTMC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[3-methyl-1-(methylamino)-1-oxobutan-2-yl]cyclohexa-1,5-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-methyl-1-(methylamino)-1-oxobutan-2-yl]cyclohexa-1,5-diene-1-carboxamide?
The IUPAC name of N-[3-methyl-1-(methylamino)-1-oxobutan-2-yl]cyclohexa-1,5-diene-1-carboxamide (CID 144745229) is N-[3-methyl-1-(methylamino)-1-oxobutan-2-yl]cyclohexa-1,5-diene-1-carboxamide.
What is the SMILES notation for N-[3-methyl-1-(methylamino)-1-oxobutan-2-yl]cyclohexa-1,5-diene-1-carboxamide?
The canonical SMILES for N-[3-methyl-1-(methylamino)-1-oxobutan-2-yl]cyclohexa-1,5-diene-1-carboxamide is CNC(=O)C(NC(=O)C1=CCCC=C1)C(C)C.
What is the InChIKey of N-[3-methyl-1-(methylamino)-1-oxobutan-2-yl]cyclohexa-1,5-diene-1-carboxamide?
The InChIKey is QQRYPJOSTYTTMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2/c1-9(2)11(13(17)14-3)15-12(16)10-7-5-4-6-8-10/h5,7-9,11H,4,6H2,1-3H3,(H,14,17)(H,15,16).
What are the key properties of N-[3-methyl-1-(methylamino)-1-oxobutan-2-yl]cyclohexa-1,5-diene-1-carboxamide?
N-[3-methyl-1-(methylamino)-1-oxobutan-2-yl]cyclohexa-1,5-diene-1-carboxamide has a molecular weight of 236.31 g/mol, XLogP of 1.15, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-methyl-1-(methylamino)-1-oxobutan-2-yl]cyclohexa-1,5-diene-1-carboxamide is sourced from PubChem (CID 144745229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).