C15H16N4O3S — CID 144745240
4-methyl-N-[3-methyl-1-(4-nitrosophenyl)-1-oxobutan-2-yl]thiadiazole-5-carboxamide (PubChem CID 144745240) has the molecular formula C15H16N4O3S and a molecular weight of 332.39 g/mol. Its IUPAC name is 4-methyl-N-[3-methyl-1-(4-nitrosophenyl)-1-oxobutan-2-yl]thiadiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[3-methyl-1-(4-nitrosophenyl)-1-oxobutan-2-yl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 144745240 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 4-methyl-N-[3-methyl-1-(4-nitrosophenyl)-1-oxobutan-2-yl]thiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)NC(C(=O)c1ccc(N=O)cc1)C(C)C |
| InChI | InChI=1S/C15H16N4O3S/c1-8(2)12(16-15(21)14-9(3)17-19-23-14)13(20)10-4-6-11(18-22)7-5-10/h4-8,12H,1-3H3,(H,16,21) |
| InChIKey | ZNHMVSQWWUDLFW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |