About 1-[2-[(2,5-dimethylidenepyrrolidin-1-yl)methyl]prop-2-enyl]-2,6-dimethylpiperidine
1-[2-[(2,5-dimethylidenepyrrolidin-1-yl)methyl]prop-2-enyl]-2,6-dimethylpiperidine (PubChem CID 144745371) has the molecular formula C17H28N2
and a molecular weight of 260.42 g/mol. Its IUPAC name is 1-[2-[(2,5-dimethylidenepyrrolidin-1-yl)methyl]prop-2-enyl]-2,6-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-[2-[(2,5-dimethylidenepyrrolidin-1-yl)methyl]prop-2-enyl]-2,6-dimethylpiperidine |
| PubChem CID | 144745371 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 1-[2-[(2,5-dimethylidenepyrrolidin-1-yl)methyl]prop-2-enyl]-2,6-dimethylpiperidine |
| SMILES | C=C(CN1C(=C)CCC1=C)CN1C(C)CCCC1C |
| InChI | InChI=1S/C17H28N2/c1-13(12-19-16(4)9-10-17(19)5)11-18-14(2)7-6-8-15(18)3/h14-15H,1,4-12H2,2-3H3 |
| InChIKey | QHCQDDQFIMRYCW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[(2,5-dimethylidenepyrrolidin-1-yl)methyl]prop-2-enyl]-2,6-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(2,5-dimethylidenepyrrolidin-1-yl)methyl]prop-2-enyl]-2,6-dimethylpiperidine?
The IUPAC name of 1-[2-[(2,5-dimethylidenepyrrolidin-1-yl)methyl]prop-2-enyl]-2,6-dimethylpiperidine (CID 144745371) is 1-[2-[(2,5-dimethylidenepyrrolidin-1-yl)methyl]prop-2-enyl]-2,6-dimethylpiperidine.
What is the SMILES notation for 1-[2-[(2,5-dimethylidenepyrrolidin-1-yl)methyl]prop-2-enyl]-2,6-dimethylpiperidine?
The canonical SMILES for 1-[2-[(2,5-dimethylidenepyrrolidin-1-yl)methyl]prop-2-enyl]-2,6-dimethylpiperidine is C=C(CN1C(=C)CCC1=C)CN1C(C)CCCC1C.
What is the InChIKey of 1-[2-[(2,5-dimethylidenepyrrolidin-1-yl)methyl]prop-2-enyl]-2,6-dimethylpiperidine?
The InChIKey is QHCQDDQFIMRYCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2/c1-13(12-19-16(4)9-10-17(19)5)11-18-14(2)7-6-8-15(18)3/h14-15H,1,4-12H2,2-3H3.
What are the key properties of 1-[2-[(2,5-dimethylidenepyrrolidin-1-yl)methyl]prop-2-enyl]-2,6-dimethylpiperidine?
1-[2-[(2,5-dimethylidenepyrrolidin-1-yl)methyl]prop-2-enyl]-2,6-dimethylpiperidine has a molecular weight of 260.42 g/mol, XLogP of 3.93, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(2,5-dimethylidenepyrrolidin-1-yl)methyl]prop-2-enyl]-2,6-dimethylpiperidine is sourced from PubChem (CID 144745371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).