C17H26N4O4 — CID 144745379
N-[3-[(1E)-1-hydroxyimino-2-methylpropan-2-yl]-1,2-oxazol-5-yl]-1-(oxan-4-yl)pyrrolidine-2-carboxamide (PubChem CID 144745379) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-[3-[(1E)-1-hydroxyimino-2-methylpropan-2-yl]-1,2-oxazol-5-yl]-1-(oxan-4-yl)pyrrolidine-2-carboxamide.
| Compound Name | N-[3-[(1E)-1-hydroxyimino-2-methylpropan-2-yl]-1,2-oxazol-5-yl]-1-(oxan-4-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 144745379 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | N-[3-[(1E)-1-hydroxyimino-2-methylpropan-2-yl]-1,2-oxazol-5-yl]-1-(oxan-4-yl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)(/C=N/O)c1cc(NC(=O)C2CCCN2C2CCOCC2)on1 |
| InChI | InChI=1S/C17H26N4O4/c1-17(2,11-18-23)14-10-15(25-20-14)19-16(22)13-4-3-7-21(13)12-5-8-24-9-6-12/h10-13,23H,3-9H2,1-2H3,(H,19,22)/b18-11+ |
| InChIKey | PHJDKPCAPOSFRH-WOJGMQOQSA-N |
| XLogP | 1.99 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|