C13H21NO2 — CID 144745524
methyl (4Z,6aS,10aS)-1,2,3,6,6a,7,8,9,10,10a-decahydro-1-benzazocine-5-carboxylate (PubChem CID 144745524) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is methyl (4Z,6aS,10aS)-1,2,3,6,6a,7,8,9,10,10a-decahydro-1-benzazocine-5-carboxylate.
| Compound Name | methyl (4Z,6aS,10aS)-1,2,3,6,6a,7,8,9,10,10a-decahydro-1-benzazocine-5-carboxylate |
|---|---|
| PubChem CID | 144745524 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | methyl (4Z,6aS,10aS)-1,2,3,6,6a,7,8,9,10,10a-decahydro-1-benzazocine-5-carboxylate |
| SMILES | COC(=O)/C1=C/CCN[C@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C13H21NO2/c1-16-13(15)11-6-4-8-14-12-7-3-2-5-10(12)9-11/h6,10,12,14H,2-5,7-9H2,1H3/b11-6+/t10-,12-/m0/s1 |
| InChIKey | XVEZQUIKZNDWER-IPDIZNINSA-N |
| XLogP | 2.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |