C20H30O4 — CID 144745728
(1S,4R,9S,12R)-9,12-dihydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one (PubChem CID 144745728) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (1S,4R,9S,12R)-9,12-dihydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one.
| Compound Name | (1S,4R,9S,12R)-9,12-dihydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
|---|---|
| PubChem CID | 144745728 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (1S,4R,9S,12R)-9,12-dihydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
| SMILES | CC1=C2[C@@H](O)C(=O)C3(C)C(C[C@H](CC1)C2(C)C)[C@@H]1COC1C[C@@H]3O |
| InChI | InChI=1S/C20H30O4/c1-10-5-6-11-7-13-12-9-24-14(12)8-15(21)20(13,4)18(23)17(22)16(10)19(11,2)3/h11-15,17,21-22H,5-9H2,1-4H3/t11-,12-,13?,14?,15-,17+,20?/m0/s1 |
| InChIKey | VEOGHACKCMCQBF-VQJOUHKTSA-N |
| XLogP | 2.47 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|