C61H58N2 — CID 144745751
7-[3,6-bis(2-methylbutan-2-yl)carbazol-9-yl]-9,9-dimethyl-N,N-bis(4-phenylphenyl)fluoren-2-amine (PubChem CID 144745751) has the molecular formula C61H58N2 and a molecular weight of 819.15 g/mol. Its IUPAC name is 7-[3,6-bis(2-methylbutan-2-yl)carbazol-9-yl]-9,9-dimethyl-N,N-bis(4-phenylphenyl)fluoren-2-amine.
| Compound Name | 7-[3,6-bis(2-methylbutan-2-yl)carbazol-9-yl]-9,9-dimethyl-N,N-bis(4-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 144745751 |
| Molecular Formula | C61H58N2 |
| Molecular Weight | 819.15 g/mol |
| Exact Mass | 818.46 |
| IUPAC Name | 7-[3,6-bis(2-methylbutan-2-yl)carbazol-9-yl]-9,9-dimethyl-N,N-bis(4-phenylphenyl)fluoren-2-amine |
| SMILES | CCC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)CC)ccc1n2-c1ccc2c(c1)C(C)(C)c1cc(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4ccccc4)cc3)ccc1-2 |
| InChI | InChI=1S/C61H58N2/c1-9-59(3,4)45-25-35-57-53(37-45)54-38-46(60(5,6)10-2)26-36-58(54)63(57)50-32-34-52-51-33-31-49(39-55(51)61(7,8)56(52)40-50)62(47-27-21-43(22-28-47)41-17-13-11-14-18-41)48-29-23-44(24-30-48)42-19-15-12-16-20-42/h11-40H,9-10H2,1-8H3 |
| InChIKey | MREQZVPRNUZNLP-UHFFFAOYSA-N |
| XLogP | 17.27 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.15 |
| LogP ≤ 5 | 17.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |