C38H64O5 — CID 144746224
(2R,3S,6R)-2-(hydroxymethyl)-7-[[(1R,2S,5R,8R,9S,14R,15R,19S,21R)-1,2,5,8,9,15,20,20-octamethyl-19-pentacyclo[12.9.0.02,11.05,10.015,21]tricos-11-enyl]oxy]oxepane-3,6-diol (PubChem CID 144746224) has the molecular formula C38H64O5 and a molecular weight of 600.93 g/mol. Its IUPAC name is (2R,3S,6R)-2-(hydroxymethyl)-7-[[(1R,2S,5R,8R,9S,14R,15R,19S,21R)-1,2,5,8,9,15,20,20-octamethyl-19-pentacyclo[12.9.0.02,11.05,10.015,21]tricos-11-enyl]oxy]oxepane-3,6-diol.
| Compound Name | (2R,3S,6R)-2-(hydroxymethyl)-7-[[(1R,2S,5R,8R,9S,14R,15R,19S,21R)-1,2,5,8,9,15,20,20-octamethyl-19-pentacyclo[12.9.0.02,11.05,10.015,21]tricos-11-enyl]oxy]oxepane-3,6-diol |
|---|---|
| PubChem CID | 144746224 |
| Molecular Formula | C38H64O5 |
| Molecular Weight | 600.93 g/mol |
| Exact Mass | 600.48 |
| IUPAC Name | (2R,3S,6R)-2-(hydroxymethyl)-7-[[(1R,2S,5R,8R,9S,14R,15R,19S,21R)-1,2,5,8,9,15,20,20-octamethyl-19-pentacyclo[12.9.0.02,11.05,10.015,21]tricos-11-enyl]oxy]oxepane-3,6-diol |
| SMILES | C[C@@H]1CC[C@]2(C)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CCC[C@H](OC6O[C@H](CO)[C@@H](O)CC[C@H]6O)C(C)(C)[C@@H]5CC[C@]43C)C2[C@H]1C |
| InChI | InChI=1S/C38H64O5/c1-23-15-18-35(5)20-21-37(7)25(32(35)24(23)2)11-14-30-36(6)17-9-10-31(34(3,4)29(36)16-19-38(30,37)8)43-33-27(41)13-12-26(40)28(22-39)42-33/h11,23-24,26-33,39-41H,9-10,12-22H2,1-8H3/t23-,24+,26+,27-,28-,29+,30-,31+,32?,33?,35-,36+,37-,38-/m1/s1 |
| InChIKey | OOYLKUVIBXJDHY-SVEXNHHBSA-N |
| XLogP | 7.66 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.93 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|