About methyl N-methylidene-N'-prop-1-en-2-ylcarbamimidate
methyl N-methylidene-N'-prop-1-en-2-ylcarbamimidate (PubChem CID 144746644) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is methyl N-methylidene-N'-prop-1-en-2-ylcarbamimidate.
Molecular Properties
| Compound Name | methyl N-methylidene-N'-prop-1-en-2-ylcarbamimidate |
| PubChem CID | 144746644 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | methyl N-methylidene-N'-prop-1-en-2-ylcarbamimidate |
| SMILES | C=N/C(=N/C(=C)C)OC |
| InChI | InChI=1S/C6H10N2O/c1-5(2)8-6(7-3)9-4/h1,3H2,2,4H3/b8-6- |
| InChIKey | PUOXXAJNCXSKGW-VURMDHGXSA-N |
| XLogP | 1.22 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-methylidene-N'-prop-1-en-2-ylcarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-methylidene-N'-prop-1-en-2-ylcarbamimidate?
The IUPAC name of methyl N-methylidene-N'-prop-1-en-2-ylcarbamimidate (CID 144746644) is methyl N-methylidene-N'-prop-1-en-2-ylcarbamimidate.
What is the SMILES notation for methyl N-methylidene-N'-prop-1-en-2-ylcarbamimidate?
The canonical SMILES for methyl N-methylidene-N'-prop-1-en-2-ylcarbamimidate is C=N/C(=N/C(=C)C)OC.
What is the InChIKey of methyl N-methylidene-N'-prop-1-en-2-ylcarbamimidate?
The InChIKey is PUOXXAJNCXSKGW-VURMDHGXSA-N. The full InChI is InChI=1S/C6H10N2O/c1-5(2)8-6(7-3)9-4/h1,3H2,2,4H3/b8-6-.
What are the key properties of methyl N-methylidene-N'-prop-1-en-2-ylcarbamimidate?
methyl N-methylidene-N'-prop-1-en-2-ylcarbamimidate has a molecular weight of 126.16 g/mol, XLogP of 1.22, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-methylidene-N'-prop-1-en-2-ylcarbamimidate is sourced from PubChem (CID 144746644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).