C13H21F2N — CID 144746654
3,3-difluoro-1-[(3E)-5-methylhexa-1,3,5-trien-3-yl]pyrrolidine;ethane (PubChem CID 144746654) has the molecular formula C13H21F2N and a molecular weight of 229.31 g/mol. Its IUPAC name is 3,3-difluoro-1-[(3E)-5-methylhexa-1,3,5-trien-3-yl]pyrrolidine;ethane.
| Compound Name | 3,3-difluoro-1-[(3E)-5-methylhexa-1,3,5-trien-3-yl]pyrrolidine;ethane |
|---|---|
| PubChem CID | 144746654 |
| Molecular Formula | C13H21F2N |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 3,3-difluoro-1-[(3E)-5-methylhexa-1,3,5-trien-3-yl]pyrrolidine;ethane |
| SMILES | C=C/C(=C\C(=C)C)N1CCC(F)(F)C1.CC |
| InChI | InChI=1S/C11H15F2N.C2H6/c1-4-10(7-9(2)3)14-6-5-11(12,13)8-14;1-2/h4,7H,1-2,5-6,8H2,3H3;1-2H3/b10-7+; |
| InChIKey | OZJHQSQBSIOTAW-HCUGZAAXSA-N |
| XLogP | 4.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|