About 2-amino-4-[4-(diethylamino)phenyl]-4-[difluoro(methyl)-λ4-sulfanyl]-2-fluorobutanoic acid
2-amino-4-[4-(diethylamino)phenyl]-4-[difluoro(methyl)-λ4-sulfanyl]-2-fluorobutanoic acid (PubChem CID 144748649) has the molecular formula C15H23F3N2O2S
and a molecular weight of 352.42 g/mol. Its IUPAC name is 2-amino-4-[4-(diethylamino)phenyl]-4-[difluoro(methyl)-λ4-sulfanyl]-2-fluorobutanoic acid.
Molecular Properties
| Compound Name | 2-amino-4-[4-(diethylamino)phenyl]-4-[difluoro(methyl)-λ4-sulfanyl]-2-fluorobutanoic acid |
| PubChem CID | 144748649 |
| Molecular Formula | C15H23F3N2O2S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-amino-4-[4-(diethylamino)phenyl]-4-[difluoro(methyl)-λ4-sulfanyl]-2-fluorobutanoic acid |
| SMILES | CCN(CC)c1ccc(C(CC(N)(F)C(=O)O)S(C)(F)F)cc1 |
| InChI | InChI=1S/C15H23F3N2O2S/c1-4-20(5-2)12-8-6-11(7-9-12)13(23(3,17)18)10-15(16,19)14(21)22/h6-9,13H,4-5,10,19H2,1-3H3,(H,21,22) |
| InChIKey | CDZAHVUMPMOHHE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-[4-(diethylamino)phenyl]-4-[difluoro(methyl)-λ4-sulfanyl]-2-fluorobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-[4-(diethylamino)phenyl]-4-[difluoro(methyl)-λ4-sulfanyl]-2-fluorobutanoic acid?
The IUPAC name of 2-amino-4-[4-(diethylamino)phenyl]-4-[difluoro(methyl)-λ4-sulfanyl]-2-fluorobutanoic acid (CID 144748649) is 2-amino-4-[4-(diethylamino)phenyl]-4-[difluoro(methyl)-λ4-sulfanyl]-2-fluorobutanoic acid.
What is the SMILES notation for 2-amino-4-[4-(diethylamino)phenyl]-4-[difluoro(methyl)-λ4-sulfanyl]-2-fluorobutanoic acid?
The canonical SMILES for 2-amino-4-[4-(diethylamino)phenyl]-4-[difluoro(methyl)-λ4-sulfanyl]-2-fluorobutanoic acid is CCN(CC)c1ccc(C(CC(N)(F)C(=O)O)S(C)(F)F)cc1.
What is the InChIKey of 2-amino-4-[4-(diethylamino)phenyl]-4-[difluoro(methyl)-λ4-sulfanyl]-2-fluorobutanoic acid?
The InChIKey is CDZAHVUMPMOHHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23F3N2O2S/c1-4-20(5-2)12-8-6-11(7-9-12)13(23(3,17)18)10-15(16,19)14(21)22/h6-9,13H,4-5,10,19H2,1-3H3,(H,21,22).
What are the key properties of 2-amino-4-[4-(diethylamino)phenyl]-4-[difluoro(methyl)-λ4-sulfanyl]-2-fluorobutanoic acid?
2-amino-4-[4-(diethylamino)phenyl]-4-[difluoro(methyl)-λ4-sulfanyl]-2-fluorobutanoic acid has a molecular weight of 352.42 g/mol, XLogP of 3.88, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-[4-(diethylamino)phenyl]-4-[difluoro(methyl)-λ4-sulfanyl]-2-fluorobutanoic acid is sourced from PubChem (CID 144748649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).