About 3-[2,3-bis(ethenyl)-1,4-benzoxazin-4-yl]propanimidamide;diazene
3-[2,3-bis(ethenyl)-1,4-benzoxazin-4-yl]propanimidamide;diazene (PubChem CID 144748693) has the molecular formula C15H19N5O
and a molecular weight of 285.35 g/mol. Its IUPAC name is 3-[2,3-bis(ethenyl)-1,4-benzoxazin-4-yl]propanimidamide;diazene.
Molecular Properties
| Compound Name | 3-[2,3-bis(ethenyl)-1,4-benzoxazin-4-yl]propanimidamide;diazene |
| PubChem CID | 144748693 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 3-[2,3-bis(ethenyl)-1,4-benzoxazin-4-yl]propanimidamide;diazene |
| SMILES | [H]/N=C(\N)CCN1C(C=C)=C(C=C)Oc2ccccc21.[H]/N=N/[H] |
| InChI | InChI=1S/C15H17N3O.H2N2/c1-3-11-13(4-2)19-14-8-6-5-7-12(14)18(11)10-9-15(16)17;1-2/h3-8H,1-2,9-10H2,(H3,16,17);1-2H/b;2-1+ |
| InChIKey | LQCFNIPSGZEDOH-WLHGVMLRSA-N |
| XLogP | 3.39 |
| TPSA | 110.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,3-bis(ethenyl)-1,4-benzoxazin-4-yl]propanimidamide;diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,3-bis(ethenyl)-1,4-benzoxazin-4-yl]propanimidamide;diazene?
The IUPAC name of 3-[2,3-bis(ethenyl)-1,4-benzoxazin-4-yl]propanimidamide;diazene (CID 144748693) is 3-[2,3-bis(ethenyl)-1,4-benzoxazin-4-yl]propanimidamide;diazene.
What is the SMILES notation for 3-[2,3-bis(ethenyl)-1,4-benzoxazin-4-yl]propanimidamide;diazene?
The canonical SMILES for 3-[2,3-bis(ethenyl)-1,4-benzoxazin-4-yl]propanimidamide;diazene is [H]/N=C(\N)CCN1C(C=C)=C(C=C)Oc2ccccc21.[H]/N=N/[H].
What is the InChIKey of 3-[2,3-bis(ethenyl)-1,4-benzoxazin-4-yl]propanimidamide;diazene?
The InChIKey is LQCFNIPSGZEDOH-WLHGVMLRSA-N. The full InChI is InChI=1S/C15H17N3O.H2N2/c1-3-11-13(4-2)19-14-8-6-5-7-12(14)18(11)10-9-15(16)17;1-2/h3-8H,1-2,9-10H2,(H3,16,17);1-2H/b;2-1+.
What are the key properties of 3-[2,3-bis(ethenyl)-1,4-benzoxazin-4-yl]propanimidamide;diazene?
3-[2,3-bis(ethenyl)-1,4-benzoxazin-4-yl]propanimidamide;diazene has a molecular weight of 285.35 g/mol, XLogP of 3.39, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,3-bis(ethenyl)-1,4-benzoxazin-4-yl]propanimidamide;diazene is sourced from PubChem (CID 144748693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).